C17H33N3O4S — CID 124805747
ethyl (3aS,8aS)-2-[2-(dimethylamino)ethyl]-5-ethylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 124805747) has the molecular formula C17H33N3O4S and a molecular weight of 375.54 g/mol. Its IUPAC name is ethyl (3aS,8aS)-2-[2-(dimethylamino)ethyl]-5-ethylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aS,8aS)-2-[2-(dimethylamino)ethyl]-5-ethylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 124805747 |
| Molecular Formula | C17H33N3O4S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | ethyl (3aS,8aS)-2-[2-(dimethylamino)ethyl]-5-ethylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCCN(S(=O)(=O)CC)C[C@@H]1CN(CCN(C)C)C2 |
| InChI | InChI=1S/C17H33N3O4S/c1-5-24-16(21)17-8-7-9-20(25(22,23)6-2)13-15(17)12-19(14-17)11-10-18(3)4/h15H,5-14H2,1-4H3/t15-,17+/m0/s1 |
| InChIKey | LXEUMGQPRJLMPN-DOTOQJQBSA-N |
| XLogP | 0.47 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |