C22H34F6N2O6 — CID 155841631
ethyl (3aS,8aR)-5-(cyclopropylmethyl)-2-propan-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155841631) has the molecular formula C22H34F6N2O6 and a molecular weight of 536.51 g/mol. Its IUPAC name is ethyl (3aS,8aR)-5-(cyclopropylmethyl)-2-propan-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | ethyl (3aS,8aR)-5-(cyclopropylmethyl)-2-propan-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155841631 |
| Molecular Formula | C22H34F6N2O6 |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | ethyl (3aS,8aR)-5-(cyclopropylmethyl)-2-propan-2-yl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOC(=O)[C@]12CCCN(CC3CC3)C[C@H]1CN(C(C)C)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H32N2O2.2C2HF3O2/c1-4-22-17(21)18-8-5-9-19(10-15-6-7-15)11-16(18)12-20(13-18)14(2)3;2*3-2(4,5)1(6)7/h14-16H,4-13H2,1-3H3;2*(H,6,7)/t16-,18-;;/m0../s1 |
| InChIKey | QGWABNASHKYRCA-RYNABIAMSA-N |
| XLogP | 3.65 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |