C28H34F6N2O8 — CID 155841039
ethyl (3aS,8aR)-2-(furan-3-ylmethyl)-5-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155841039) has the molecular formula C28H34F6N2O8 and a molecular weight of 640.57 g/mol. Its IUPAC name is ethyl (3aS,8aR)-2-(furan-3-ylmethyl)-5-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | ethyl (3aS,8aR)-2-(furan-3-ylmethyl)-5-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155841039 |
| Molecular Formula | C28H34F6N2O8 |
| Molecular Weight | 640.57 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | ethyl (3aS,8aR)-2-(furan-3-ylmethyl)-5-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3ccc(OC)cc3)C[C@H]1CN(Cc1ccoc1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H32N2O4.2C2HF3O2/c1-3-30-23(27)24-10-4-11-25(13-19-5-7-22(28-2)8-6-19)15-21(24)16-26(18-24)14-20-9-12-29-17-20;2*3-2(4,5)1(6)7/h5-9,12,17,21H,3-4,10-11,13-16,18H2,1-2H3;2*(H,6,7)/t21-,24-;;/m0../s1 |
| InChIKey | ORWQAKUQMWARGR-XQXCFHDDSA-N |
| XLogP | 4.83 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |