C23H32F6N2O6S — CID 127021523
ethyl (3aS,8aR)-2-propan-2-yl-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127021523) has the molecular formula C23H32F6N2O6S and a molecular weight of 578.57 g/mol. Its IUPAC name is ethyl (3aS,8aR)-2-propan-2-yl-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | ethyl (3aS,8aR)-2-propan-2-yl-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127021523 |
| Molecular Formula | C23H32F6N2O6S |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | ethyl (3aS,8aR)-2-propan-2-yl-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3cccs3)C[C@H]1CN(C(C)C)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H30N2O2S.2C2HF3O2/c1-4-23-18(22)19-8-6-9-20(13-17-7-5-10-24-17)11-16(19)12-21(14-19)15(2)3;2*3-2(4,5)1(6)7/h5,7,10,15-16H,4,6,8-9,11-14H2,1-3H3;2*(H,6,7)/t16-,19-;;/m0../s1 |
| InChIKey | YCHKBOFMZKTXKO-VBKBRSQCSA-N |
| XLogP | 4.50 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |