C16H25N3O2S — CID 97459682
(3aS,8aR)-2-propan-2-yl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid (PubChem CID 97459682) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is (3aS,8aR)-2-propan-2-yl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid.
| Compound Name | (3aS,8aR)-2-propan-2-yl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid |
|---|---|
| PubChem CID | 97459682 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (3aS,8aR)-2-propan-2-yl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid |
| SMILES | CC(C)N1C[C@@H]2CN(Cc3nccs3)CCC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C16H25N3O2S/c1-12(2)19-9-13-8-18(10-14-17-5-7-22-14)6-3-4-16(13,11-19)15(20)21/h5,7,12-13H,3-4,6,8-11H2,1-2H3,(H,20,21)/t13-,16-/m0/s1 |
| InChIKey | CAXVTDKKZCOCMI-BBRMVZONSA-N |
| XLogP | 2.15 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |