C15H23N3O2S — CID 97459676
(3aR,8aR)-2-ethyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid (PubChem CID 97459676) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is (3aR,8aR)-2-ethyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid.
| Compound Name | (3aR,8aR)-2-ethyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid |
|---|---|
| PubChem CID | 97459676 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (3aR,8aR)-2-ethyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid |
| SMILES | CCN1C[C@@H]2CN(Cc3nccs3)CCC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C15H23N3O2S/c1-2-17-8-12-9-18(10-13-16-5-7-21-13)6-3-4-15(12,11-17)14(19)20/h5,7,12H,2-4,6,8-11H2,1H3,(H,19,20)/t12-,15+/m1/s1 |
| InChIKey | PTKNHFYXXPPUNT-DOMZBBRYSA-N |
| XLogP | 1.76 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |