C21H28F6N2O7S — CID 155825804
(3aR,8aR)-2-(2-methoxyethyl)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155825804) has the molecular formula C21H28F6N2O7S and a molecular weight of 566.52 g/mol. Its IUPAC name is (3aR,8aR)-2-(2-methoxyethyl)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,8aR)-2-(2-methoxyethyl)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155825804 |
| Molecular Formula | C21H28F6N2O7S |
| Molecular Weight | 566.52 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | (3aR,8aR)-2-(2-methoxyethyl)-5-(thiophen-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCN1C[C@@H]2CN(Cc3cccs3)CCC[C@]2(C(=O)O)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2O3S.2C2HF3O2/c1-22-8-7-19-11-14-10-18(12-15-4-2-9-23-15)6-3-5-17(14,13-19)16(20)21;2*3-2(4,5)1(6)7/h2,4,9,14H,3,5-8,10-13H2,1H3,(H,20,21);2*(H,6,7)/t14-,17-;;/m0../s1 |
| InChIKey | ZWYPFLKINNQEDK-YHOFXEKLSA-N |
| XLogP | 3.26 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |