C26H31F6N3O7 — CID 171695721
ethyl (3aS,8aR)-2-(furan-3-ylmethyl)-5-(pyridin-3-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171695721) has the molecular formula C26H31F6N3O7 and a molecular weight of 611.54 g/mol. Its IUPAC name is ethyl (3aS,8aR)-2-(furan-3-ylmethyl)-5-(pyridin-3-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | ethyl (3aS,8aR)-2-(furan-3-ylmethyl)-5-(pyridin-3-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171695721 |
| Molecular Formula | C26H31F6N3O7 |
| Molecular Weight | 611.54 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | ethyl (3aS,8aR)-2-(furan-3-ylmethyl)-5-(pyridin-3-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3cccnc3)C[C@H]1CN(Cc1ccoc1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H29N3O3.2C2HF3O2/c1-2-28-21(26)22-7-4-9-24(12-18-5-3-8-23-11-18)14-20(22)15-25(17-22)13-19-6-10-27-16-19;2*3-2(4,5)1(6)7/h3,5-6,8,10-11,16,20H,2,4,7,9,12-15,17H2,1H3;2*(H,6,7)/t20-,22-;;/m0../s1 |
| InChIKey | KKJUXCWWCOVSDZ-HWELVIDPSA-N |
| XLogP | 4.22 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |