C21H28F6N2O6 — CID 155832725
4a-(ethoxymethyl)-6-(pyridin-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155832725) has the molecular formula C21H28F6N2O6 and a molecular weight of 518.45 g/mol. Its IUPAC name is 4a-(ethoxymethyl)-6-(pyridin-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4a-(ethoxymethyl)-6-(pyridin-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155832725 |
| Molecular Formula | C21H28F6N2O6 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 4a-(ethoxymethyl)-6-(pyridin-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOCC12CCCOC1CCN(Cc1cccnc1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2O2.2C2HF3O2/c1-2-20-14-17-7-4-10-21-16(17)6-9-19(13-17)12-15-5-3-8-18-11-15;2*3-2(4,5)1(6)7/h3,5,8,11,16H,2,4,6-7,9-10,12-14H2,1H3;2*(H,6,7) |
| InChIKey | GCTMXHWXIJURTC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |