C23H26F6N2O6S — CID 155842967
(3aS,7aR)-3a-(pyridin-3-ylmethoxymethyl)-5-(thiophen-3-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155842967) has the molecular formula C23H26F6N2O6S and a molecular weight of 572.52 g/mol. Its IUPAC name is (3aS,7aR)-3a-(pyridin-3-ylmethoxymethyl)-5-(thiophen-3-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,7aR)-3a-(pyridin-3-ylmethoxymethyl)-5-(thiophen-3-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155842967 |
| Molecular Formula | C23H26F6N2O6S |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | (3aS,7aR)-3a-(pyridin-3-ylmethoxymethyl)-5-(thiophen-3-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cncc(COC[C@@]23CCO[C@@H]2CCN(Cc2ccsc2)C3)c1 |
| InChI | InChI=1S/C19H24N2O2S.2C2HF3O2/c1-2-16(10-20-6-1)12-22-15-19-5-8-23-18(19)3-7-21(14-19)11-17-4-9-24-13-17;2*3-2(4,5)1(6)7/h1-2,4,6,9-10,13,18H,3,5,7-8,11-12,14-15H2;2*(H,6,7)/t18-,19+;;/m1../s1 |
| InChIKey | NYPSOUWIHMDSGB-QNCHGCKQSA-N |
| XLogP | 4.61 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |