C18H25F3N2O4 — CID 171697223
4a-(methoxymethyl)-6-(pyridin-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 171697223) has the molecular formula C18H25F3N2O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 4a-(methoxymethyl)-6-(pyridin-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 4a-(methoxymethyl)-6-(pyridin-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171697223 |
| Molecular Formula | C18H25F3N2O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4a-(methoxymethyl)-6-(pyridin-3-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | COCC12CCCOC1CCN(Cc1cccnc1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N2O2.C2HF3O2/c1-19-13-16-6-3-9-20-15(16)5-8-18(12-16)11-14-4-2-7-17-10-14;3-2(4,5)1(6)7/h2,4,7,10,15H,3,5-6,8-9,11-13H2,1H3;(H,6,7) |
| InChIKey | JCWJMNRCTFUCIJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |