C23H27F6N3O6S — CID 155829724
(3aS,7aR)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-3a-(pyridin-3-ylmethoxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155829724) has the molecular formula C23H27F6N3O6S and a molecular weight of 587.54 g/mol. Its IUPAC name is (3aS,7aR)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-3a-(pyridin-3-ylmethoxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,7aR)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-3a-(pyridin-3-ylmethoxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155829724 |
| Molecular Formula | C23H27F6N3O6S |
| Molecular Weight | 587.54 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | (3aS,7aR)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-3a-(pyridin-3-ylmethoxymethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ncsc1CN1CC[C@H]2OCC[C@@]2(COCc2cccnc2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25N3O2S.2C2HF3O2/c1-15-17(25-14-21-15)10-22-7-4-18-19(12-22,5-8-24-18)13-23-11-16-3-2-6-20-9-16;2*3-2(4,5)1(6)7/h2-3,6,9,14,18H,4-5,7-8,10-13H2,1H3;2*(H,6,7)/t18-,19+;;/m1../s1 |
| InChIKey | BHGDXUCYPROVNM-QNCHGCKQSA-N |
| XLogP | 4.31 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |