C18H26F3NO4S — CID 155845411
4a-(ethoxymethyl)-6-(thiophen-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155845411) has the molecular formula C18H26F3NO4S and a molecular weight of 409.47 g/mol. Its IUPAC name is 4a-(ethoxymethyl)-6-(thiophen-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 4a-(ethoxymethyl)-6-(thiophen-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845411 |
| Molecular Formula | C18H26F3NO4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4a-(ethoxymethyl)-6-(thiophen-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | CCOCC12CCCOC1CCN(Cc1cccs1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25NO2S.C2HF3O2/c1-2-18-13-16-7-4-9-19-15(16)6-8-17(12-16)11-14-5-3-10-20-14;3-2(4,5)1(6)7/h3,5,10,15H,2,4,6-9,11-13H2,1H3;(H,6,7) |
| InChIKey | MUYQFSAGOVZWIF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |