C17H27NO2S — CID 131640960
4a-(ethoxymethyl)-6-[(5-methylthiophen-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine (PubChem CID 131640960) has the molecular formula C17H27NO2S and a molecular weight of 309.47 g/mol. Its IUPAC name is 4a-(ethoxymethyl)-6-[(5-methylthiophen-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine.
| Compound Name | 4a-(ethoxymethyl)-6-[(5-methylthiophen-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 131640960 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 4a-(ethoxymethyl)-6-[(5-methylthiophen-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
| SMILES | CCOCC12CCCOC1CCN(Cc1ccc(C)s1)C2 |
| InChI | InChI=1S/C17H27NO2S/c1-3-19-13-17-8-4-10-20-16(17)7-9-18(12-17)11-15-6-5-14(2)21-15/h5-6,16H,3-4,7-13H2,1-2H3 |
| InChIKey | DTQQCEULVMFKQV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |