C18H28N2O3S — CID 97422571
2-[[(3aS,7aR)-5-[(5-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]methoxy]-N,N-dimethylacetamide (PubChem CID 97422571) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-[[(3aS,7aR)-5-[(5-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]methoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3aS,7aR)-5-[(5-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]methoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 97422571 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-[[(3aS,7aR)-5-[(5-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]methoxy]-N,N-dimethylacetamide |
| SMILES | Cc1ccc(CN2CC[C@H]3OCC[C@@]3(COCC(=O)N(C)C)C2)s1 |
| InChI | InChI=1S/C18H28N2O3S/c1-14-4-5-15(24-14)10-20-8-6-16-18(12-20,7-9-23-16)13-22-11-17(21)19(2)3/h4-5,16H,6-13H2,1-3H3/t16-,18+/m1/s1 |
| InChIKey | ZKDYDQWECKJRCZ-AEFFLSMTSA-N |
| XLogP | 2.14 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |