C15H28N2O5S — CID 98816431
2-[[(4aS,8aR)-6-ethylsulfonyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylacetamide (PubChem CID 98816431) has the molecular formula C15H28N2O5S and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-[[(4aS,8aR)-6-ethylsulfonyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[[(4aS,8aR)-6-ethylsulfonyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 98816431 |
| Molecular Formula | C15H28N2O5S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[[(4aS,8aR)-6-ethylsulfonyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-4a-yl]methoxy]-N,N-dimethylacetamide |
| SMILES | CCS(=O)(=O)N1CC[C@H]2OCCC[C@@]2(COCC(=O)N(C)C)C1 |
| InChI | InChI=1S/C15H28N2O5S/c1-4-23(19,20)17-8-6-13-15(11-17,7-5-9-22-13)12-21-10-14(18)16(2)3/h13H,4-12H2,1-3H3/t13-,15+/m1/s1 |
| InChIKey | KPZBXBIJBXFZET-HIFRSBDPSA-N |
| XLogP | 0.31 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |