C14H22N2O2S — CID 131647084
4a-(methoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine (PubChem CID 131647084) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 4a-(methoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine.
| Compound Name | 4a-(methoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 131647084 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4a-(methoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
| SMILES | COCC12CCCOC1CCN(Cc1nccs1)C2 |
| InChI | InChI=1S/C14H22N2O2S/c1-17-11-14-4-2-7-18-12(14)3-6-16(10-14)9-13-15-5-8-19-13/h5,8,12H,2-4,6-7,9-11H2,1H3 |
| InChIKey | ICEGIXBQEWTQGY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |