C15H23NO2S — CID 124912417
(3aR,7aS)-3a-(methoxymethyl)-5-[(3-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine (PubChem CID 124912417) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is (3aR,7aS)-3a-(methoxymethyl)-5-[(3-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine.
| Compound Name | (3aR,7aS)-3a-(methoxymethyl)-5-[(3-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 124912417 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3aR,7aS)-3a-(methoxymethyl)-5-[(3-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine |
| SMILES | COC[C@]12CCO[C@H]1CCN(Cc1sccc1C)C2 |
| InChI | InChI=1S/C15H23NO2S/c1-12-4-8-19-13(12)9-16-6-3-14-15(10-16,11-17-2)5-7-18-14/h4,8,14H,3,5-7,9-11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | HSOIYSIZFLLJNV-LSDHHAIUSA-N |
| XLogP | 2.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |