C20H30F3N3O4S — CID 155845702
3-[2-[(3aS,7aR)-5-[(3-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid (PubChem CID 155845702) has the molecular formula C20H30F3N3O4S and a molecular weight of 465.54 g/mol. Its IUPAC name is 3-[2-[(3aS,7aR)-5-[(3-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[(3aS,7aR)-5-[(3-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845702 |
| Molecular Formula | C20H30F3N3O4S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 3-[2-[(3aS,7aR)-5-[(3-methylthiophen-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccsc1CN1CC[C@H]2OCC[C@@]2(CCNC(=O)N(C)C)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H29N3O2S.C2HF3O2/c1-14-5-11-24-15(14)12-21-9-4-16-18(13-21,7-10-23-16)6-8-19-17(22)20(2)3;3-2(4,5)1(6)7/h5,11,16H,4,6-10,12-13H2,1-3H3,(H,19,22);(H,6,7)/t16-,18+;/m1./s1 |
| InChIKey | UUZFXZDPROGVGT-CLRXKPRGSA-N |
| XLogP | 3.33 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |