C16H25NO3 — CID 97379525
(4aS,8aS)-4a-(ethoxymethyl)-6-(furan-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine (PubChem CID 97379525) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (4aS,8aS)-4a-(ethoxymethyl)-6-(furan-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine.
| Compound Name | (4aS,8aS)-4a-(ethoxymethyl)-6-(furan-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 97379525 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (4aS,8aS)-4a-(ethoxymethyl)-6-(furan-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine |
| SMILES | CCOC[C@@]12CCCO[C@H]1CCN(Cc1ccco1)C2 |
| InChI | InChI=1S/C16H25NO3/c1-2-18-13-16-7-4-10-20-15(16)6-8-17(12-16)11-14-5-3-9-19-14/h3,5,9,15H,2,4,6-8,10-13H2,1H3/t15-,16-/m0/s1 |
| InChIKey | XKBHRIAJUFNVCY-HOTGVXAUSA-N |
| XLogP | 2.69 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |