C18H27F3N2O5 — CID 155823841
4a-(ethoxymethyl)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155823841) has the molecular formula C18H27F3N2O5 and a molecular weight of 408.42 g/mol. Its IUPAC name is 4a-(ethoxymethyl)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 4a-(ethoxymethyl)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155823841 |
| Molecular Formula | C18H27F3N2O5 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4a-(ethoxymethyl)-6-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | CCOCC12CCCOC1CCN(Cc1cc(C)on1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N2O3.C2HF3O2/c1-3-19-12-16-6-4-8-20-15(16)5-7-18(11-16)10-14-9-13(2)21-17-14;3-2(4,5)1(6)7/h9,15H,3-8,10-12H2,1-2H3;(H,6,7) |
| InChIKey | ROOKFITVJIYOSS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |