C23H27F6N3O7 — CID 155835081
6-[(5-methyl-1,2-oxazol-3-yl)methyl]-4a-(pyridin-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155835081) has the molecular formula C23H27F6N3O7 and a molecular weight of 571.47 g/mol. Its IUPAC name is 6-[(5-methyl-1,2-oxazol-3-yl)methyl]-4a-(pyridin-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 6-[(5-methyl-1,2-oxazol-3-yl)methyl]-4a-(pyridin-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155835081 |
| Molecular Formula | C23H27F6N3O7 |
| Molecular Weight | 571.47 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 6-[(5-methyl-1,2-oxazol-3-yl)methyl]-4a-(pyridin-2-yloxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cc(CN2CCC3OCCCC3(COc3ccccn3)C2)no1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25N3O3.2C2HF3O2/c1-15-11-16(21-25-15)12-22-9-6-17-19(13-22,7-4-10-23-17)14-24-18-5-2-3-8-20-18;2*3-2(4,5)1(6)7/h2-3,5,8,11,17H,4,6-7,9-10,12-14H2,1H3;2*(H,6,7) |
| InChIKey | RMTCUCYOPLSSHN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |