C22H34FN3O2 — CID 97378681
ethyl (3aS,8aR)-2-[2-(dimethylamino)ethyl]-5-[(4-fluorophenyl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 97378681) has the molecular formula C22H34FN3O2 and a molecular weight of 391.53 g/mol. Its IUPAC name is ethyl (3aS,8aR)-2-[2-(dimethylamino)ethyl]-5-[(4-fluorophenyl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aS,8aR)-2-[2-(dimethylamino)ethyl]-5-[(4-fluorophenyl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 97378681 |
| Molecular Formula | C22H34FN3O2 |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | ethyl (3aS,8aR)-2-[2-(dimethylamino)ethyl]-5-[(4-fluorophenyl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3ccc(F)cc3)C[C@H]1CN(CCN(C)C)C2 |
| InChI | InChI=1S/C22H34FN3O2/c1-4-28-21(27)22-10-5-11-25(14-18-6-8-20(23)9-7-18)15-19(22)16-26(17-22)13-12-24(2)3/h6-9,19H,4-5,10-17H2,1-3H3/t19-,22-/m0/s1 |
| InChIKey | POPBYOXPBWOFBW-UGKGYDQZSA-N |
| XLogP | 2.46 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |