C21H37N3O4 — CID 97378696
ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(oxane-4-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 97378696) has the molecular formula C21H37N3O4 and a molecular weight of 395.54 g/mol. Its IUPAC name is ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(oxane-4-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(oxane-4-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 97378696 |
| Molecular Formula | C21H37N3O4 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | ethyl (3aR,8aR)-2-[2-(dimethylamino)ethyl]-5-(oxane-4-carbonyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN(C(=O)C3CCOCC3)C[C@H]1CN(CCN(C)C)C2 |
| InChI | InChI=1S/C21H37N3O4/c1-4-28-20(26)21-8-5-9-24(19(25)17-6-12-27-13-7-17)15-18(21)14-23(16-21)11-10-22(2)3/h17-18H,4-16H2,1-3H3/t18-,21+/m1/s1 |
| InChIKey | APQKSTSHOIHHEV-NQIIRXRSSA-N |
| XLogP | 1.08 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |