C15H26N2O5S — CID 97378764
ethyl (3aR,8aR)-2-acetyl-5-ethylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate (PubChem CID 97378764) has the molecular formula C15H26N2O5S and a molecular weight of 346.45 g/mol. Its IUPAC name is ethyl (3aR,8aR)-2-acetyl-5-ethylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate.
| Compound Name | ethyl (3aR,8aR)-2-acetyl-5-ethylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
|---|---|
| PubChem CID | 97378764 |
| Molecular Formula | C15H26N2O5S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | ethyl (3aR,8aR)-2-acetyl-5-ethylsulfonyl-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN(S(=O)(=O)CC)C[C@H]1CN(C(C)=O)C2 |
| InChI | InChI=1S/C15H26N2O5S/c1-4-22-14(19)15-7-6-8-17(23(20,21)5-2)10-13(15)9-16(11-15)12(3)18/h13H,4-11H2,1-3H3/t13-,15+/m1/s1 |
| InChIKey | KVFVXAUBGRPDHF-HIFRSBDPSA-N |
| XLogP | 0.46 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |