C17H26FN3O2S — CID 124876390
(9aS)-8-[(4-fluorophenyl)methyl]-4,4-dimethyl-2-methylsulfonyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine (PubChem CID 124876390) has the molecular formula C17H26FN3O2S and a molecular weight of 355.48 g/mol. Its IUPAC name is (9aS)-8-[(4-fluorophenyl)methyl]-4,4-dimethyl-2-methylsulfonyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine.
| Compound Name | (9aS)-8-[(4-fluorophenyl)methyl]-4,4-dimethyl-2-methylsulfonyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 124876390 |
| Molecular Formula | C17H26FN3O2S |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (9aS)-8-[(4-fluorophenyl)methyl]-4,4-dimethyl-2-methylsulfonyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine |
| SMILES | CC1(C)CN(S(C)(=O)=O)C[C@@H]2CN(Cc3ccc(F)cc3)CCN21 |
| InChI | InChI=1S/C17H26FN3O2S/c1-17(2)13-20(24(3,22)23)12-16-11-19(8-9-21(16)17)10-14-4-6-15(18)7-5-14/h4-7,16H,8-13H2,1-3H3/t16-/m0/s1 |
| InChIKey | NBEUPOJAIOMIFK-INIZCTEOSA-N |
| XLogP | 1.37 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |