C22H24N2O4 — CID 2755637
diethyl (3R)-3,6-diphenyl-3,6-dihydropyridazine-1,2-dicarboxylate (PubChem CID 2755637) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is diethyl (3R)-3,6-diphenyl-3,6-dihydropyridazine-1,2-dicarboxylate.
| Compound Name | diethyl (3R)-3,6-diphenyl-3,6-dihydropyridazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 2755637 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | diethyl (3R)-3,6-diphenyl-3,6-dihydropyridazine-1,2-dicarboxylate |
| SMILES | CCOC(=O)N1C(c2ccccc2)C=C[C@H](c2ccccc2)N1C(=O)OCC |
| InChI | InChI=1S/C22H24N2O4/c1-3-27-21(25)23-19(17-11-7-5-8-12-17)15-16-20(18-13-9-6-10-14-18)24(23)22(26)28-4-2/h5-16,19-20H,3-4H2,1-2H3/t19-,20?/m1/s1 |
| InChIKey | DNDWOOYOJNPXEM-FIWHBWSRSA-N |
| XLogP | 4.87 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|