C12H14N2O2 — CID 3079077
ethyl 3-phenyl-3,4-dihydropyrazole-2-carboxylate (PubChem CID 3079077) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is ethyl 3-phenyl-3,4-dihydropyrazole-2-carboxylate.
| Compound Name | ethyl 3-phenyl-3,4-dihydropyrazole-2-carboxylate |
|---|---|
| PubChem CID | 3079077 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | ethyl 3-phenyl-3,4-dihydropyrazole-2-carboxylate |
| SMILES | CCOC(=O)N1N=CCC1c1ccccc1 |
| InChI | InChI=1S/C12H14N2O2/c1-2-16-12(15)14-11(8-9-13-14)10-6-4-3-5-7-10/h3-7,9,11H,2,8H2,1H3 |
| InChIKey | PJLJTYCTXHSVAA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |