C20H26N2O4 — CID 134866146
diethyl (5R,6R)-5-phenyl-6-prop-2-enyl-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 134866146) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is diethyl (5R,6R)-5-phenyl-6-prop-2-enyl-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | diethyl (5R,6R)-5-phenyl-6-prop-2-enyl-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134866146 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | diethyl (5R,6R)-5-phenyl-6-prop-2-enyl-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | C=CC[C@H]1C2CC([C@H]1c1ccccc1)N(C(=O)OCC)N2C(=O)OCC |
| InChI | InChI=1S/C20H26N2O4/c1-4-10-15-16-13-17(18(15)14-11-8-7-9-12-14)22(20(24)26-6-3)21(16)19(23)25-5-2/h4,7-9,11-12,15-18H,1,5-6,10,13H2,2-3H3/t15-,16?,17?,18-/m0/s1 |
| InChIKey | GFXLPQOWBUACHN-BFWZDYSYSA-N |
| XLogP | 3.95 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|