C24H30N2O6 — CID 102432938
dipropan-2-yl (1S,2R,9Z,10S,11R)-9-(2-ethoxy-2-oxoethylidene)-12,13-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene-12,13-dicarboxylate (PubChem CID 102432938) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is dipropan-2-yl (1S,2R,9Z,10S,11R)-9-(2-ethoxy-2-oxoethylidene)-12,13-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene-12,13-dicarboxylate.
| Compound Name | dipropan-2-yl (1S,2R,9Z,10S,11R)-9-(2-ethoxy-2-oxoethylidene)-12,13-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene-12,13-dicarboxylate |
|---|---|
| PubChem CID | 102432938 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | dipropan-2-yl (1S,2R,9Z,10S,11R)-9-(2-ethoxy-2-oxoethylidene)-12,13-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-triene-12,13-dicarboxylate |
| SMILES | CCOC(=O)/C=C1\c2ccccc2[C@H]2[C@@H]1[C@H]1C[C@@H]2N(C(=O)OC(C)C)N1C(=O)OC(C)C |
| InChI | InChI=1S/C24H30N2O6/c1-6-30-20(27)11-17-15-9-7-8-10-16(15)21-18-12-19(22(17)21)26(24(29)32-14(4)5)25(18)23(28)31-13(2)3/h7-11,13-14,18-19,21-22H,6,12H2,1-5H3/b17-11+/t18-,19+,21+,22-/m0/s1 |
| InChIKey | MZOIFAMXYDTOEK-OOPPDPSHSA-N |
| XLogP | 4.11 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|