About dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate
dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate (PubChem CID 177480250) has the molecular formula C14H22N2O6
and a molecular weight of 314.34 g/mol. Its IUPAC name is dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate |
| PubChem CID | 177480250 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)/C=C1/CN(C(=O)OC(C)C)N1C(=O)OC(C)C |
| InChI | InChI=1S/C14H22N2O6/c1-6-20-12(17)7-11-8-15(13(18)21-9(2)3)16(11)14(19)22-10(4)5/h7,9-10H,6,8H2,1-5H3/b11-7- |
| InChIKey | JBCBDXGJESMXQB-XFFZJAGNSA-N |
| XLogP | 2.06 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate?
The IUPAC name of dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate (CID 177480250) is dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate.
What is the SMILES notation for dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate?
The canonical SMILES for dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate is CCOC(=O)/C=C1/CN(C(=O)OC(C)C)N1C(=O)OC(C)C.
What is the InChIKey of dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate?
The InChIKey is JBCBDXGJESMXQB-XFFZJAGNSA-N. The full InChI is InChI=1S/C14H22N2O6/c1-6-20-12(17)7-11-8-15(13(18)21-9(2)3)16(11)14(19)22-10(4)5/h7,9-10H,6,8H2,1-5H3/b11-7-.
What are the key properties of dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate?
dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate has a molecular weight of 314.34 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate is sourced from PubChem (CID 177480250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).