C14H22N2O6 — CID 177480250
dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate (PubChem CID 177480250) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate.
| Compound Name | dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 177480250 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | dipropan-2-yl (3Z)-3-(2-ethoxy-2-oxoethylidene)diazetidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)/C=C1/CN(C(=O)OC(C)C)N1C(=O)OC(C)C |
| InChI | InChI=1S/C14H22N2O6/c1-6-20-12(17)7-11-8-15(13(18)21-9(2)3)16(11)14(19)22-10(4)5/h7,9-10H,6,8H2,1-5H3/b11-7- |
| InChIKey | JBCBDXGJESMXQB-XFFZJAGNSA-N |
| XLogP | 2.06 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|