C14H16ClNO2 — CID 11065361
ethyl (2E)-2-[1-(4-chlorophenyl)pyrrolidin-2-ylidene]acetate (PubChem CID 11065361) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is ethyl (2E)-2-[1-(4-chlorophenyl)pyrrolidin-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[1-(4-chlorophenyl)pyrrolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 11065361 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | ethyl (2E)-2-[1-(4-chlorophenyl)pyrrolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CCCN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClNO2/c1-2-18-14(17)10-13-4-3-9-16(13)12-7-5-11(15)6-8-12/h5-8,10H,2-4,9H2,1H3/b13-10+ |
| InChIKey | POPBIUKYOMTCOK-JLHYYAGUSA-N |
| XLogP | 3.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|