About ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate
ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate (PubChem CID 135076181) has the molecular formula C16H20BrNO4
and a molecular weight of 370.24 g/mol. Its IUPAC name is ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate |
| PubChem CID | 135076181 |
| Molecular Formula | C16H20BrNO4 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CCCN1c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C16H20BrNO4/c1-4-22-16(19)8-11-6-5-7-18(11)13-10-15(21-3)14(20-2)9-12(13)17/h8-10H,4-7H2,1-3H3/b11-8+ |
| InChIKey | OZTZIOWFJGJYJH-DHZHZOJOSA-N |
| XLogP | 3.51 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate?
The IUPAC name of ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate (CID 135076181) is ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate.
What is the SMILES notation for ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate?
The canonical SMILES for ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate is CCOC(=O)/C=C1\CCCN1c1cc(OC)c(OC)cc1Br.
What is the InChIKey of ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate?
The InChIKey is OZTZIOWFJGJYJH-DHZHZOJOSA-N. The full InChI is InChI=1S/C16H20BrNO4/c1-4-22-16(19)8-11-6-5-7-18(11)13-10-15(21-3)14(20-2)9-12(13)17/h8-10H,4-7H2,1-3H3/b11-8+.
What are the key properties of ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate?
ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate has a molecular weight of 370.24 g/mol, XLogP of 3.51, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-2-[1-(2-bromo-4,5-dimethoxyphenyl)pyrrolidin-2-ylidene]acetate is sourced from PubChem (CID 135076181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).