C19H25NO4 — CID 68629017
ethyl 2-[(4aR,10bR)-8,9-dimethoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene]acetate (PubChem CID 68629017) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is ethyl 2-[(4aR,10bR)-8,9-dimethoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene]acetate.
| Compound Name | ethyl 2-[(4aR,10bR)-8,9-dimethoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene]acetate |
|---|---|
| PubChem CID | 68629017 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethyl 2-[(4aR,10bR)-8,9-dimethoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene]acetate |
| SMILES | CCOC(=O)C=C1N[C@@H]2CCCC[C@@H]2c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C19H25NO4/c1-4-24-19(21)11-16-14-10-18(23-3)17(22-2)9-13(14)12-7-5-6-8-15(12)20-16/h9-12,15,20H,4-8H2,1-3H3/t12-,15-/m1/s1 |
| InChIKey | MOTWZFMNDLLRIZ-IUODEOHRSA-N |
| XLogP | 3.24 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|