C25H35N3O3 — CID 70088505
2-(9-ethoxy-8-methoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene)-2-(2-piperidin-1-ylethoxy)acetonitrile (PubChem CID 70088505) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 2-(9-ethoxy-8-methoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene)-2-(2-piperidin-1-ylethoxy)acetonitrile.
| Compound Name | 2-(9-ethoxy-8-methoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene)-2-(2-piperidin-1-ylethoxy)acetonitrile |
|---|---|
| PubChem CID | 70088505 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 2-(9-ethoxy-8-methoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene)-2-(2-piperidin-1-ylethoxy)acetonitrile |
| SMILES | CCOc1cc2c(cc1OC)C(=C(C#N)OCCN1CCCCC1)NC1CCCCC21 |
| InChI | InChI=1S/C25H35N3O3/c1-3-30-23-15-19-18-9-5-6-10-21(18)27-25(20(19)16-22(23)29-2)24(17-26)31-14-13-28-11-7-4-8-12-28/h15-16,18,21,27H,3-14H2,1-2H3 |
| InChIKey | GXFBVIKMFWYGSE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|