C23H33N3O2 — CID 70094408
2-(6-ethoxy-3-ethyl-7-methoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-5-pyrrolidin-1-ylpentanenitrile (PubChem CID 70094408) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-(6-ethoxy-3-ethyl-7-methoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-5-pyrrolidin-1-ylpentanenitrile.
| Compound Name | 2-(6-ethoxy-3-ethyl-7-methoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-5-pyrrolidin-1-ylpentanenitrile |
|---|---|
| PubChem CID | 70094408 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 2-(6-ethoxy-3-ethyl-7-methoxy-3,4-dihydro-2H-isoquinolin-1-ylidene)-5-pyrrolidin-1-ylpentanenitrile |
| SMILES | CCOc1cc2c(cc1OC)C(=C(C#N)CCCN1CCCC1)NC(CC)C2 |
| InChI | InChI=1S/C23H33N3O2/c1-4-19-13-18-14-22(28-5-2)21(27-3)15-20(18)23(25-19)17(16-24)9-8-12-26-10-6-7-11-26/h14-15,19,25H,4-13H2,1-3H3 |
| InChIKey | KGYRXWVPIZJXRC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|