C12H13FO3 — CID 149158752
6-ethoxy-2-fluoro-5-methoxy-2,3-dihydroinden-1-one (PubChem CID 149158752) has the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. Its IUPAC name is 6-ethoxy-2-fluoro-5-methoxy-2,3-dihydroinden-1-one.
| Compound Name | 6-ethoxy-2-fluoro-5-methoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 149158752 |
| Molecular Formula | C12H13FO3 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 6-ethoxy-2-fluoro-5-methoxy-2,3-dihydroinden-1-one |
| SMILES | CCOc1cc2c(cc1OC)CC(F)C2=O |
| InChI | InChI=1S/C12H13FO3/c1-3-16-11-6-8-7(5-10(11)15-2)4-9(13)12(8)14/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | WVECJOOHTHMTGD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |