C14H16O5 — CID 14128308
3-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)propanoic acid (PubChem CID 14128308) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)propanoic acid.
| Compound Name | 3-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)propanoic acid |
|---|---|
| PubChem CID | 14128308 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)propanoic acid |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CCC(=O)O)C2 |
| InChI | InChI=1S/C14H16O5/c1-18-11-6-9-5-8(3-4-13(15)16)14(17)10(9)7-12(11)19-2/h6-8H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | YKJBFFYDOQIXIU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |