C17H17NO3 — CID 95561603
(2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one (PubChem CID 95561603) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one.
| Compound Name | (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 95561603 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)[C@H](Cc1cccnc1)C2 |
| InChI | InChI=1S/C17H17NO3/c1-20-15-8-12-7-13(6-11-4-3-5-18-10-11)17(19)14(12)9-16(15)21-2/h3-5,8-10,13H,6-7H2,1-2H3/t13-/m1/s1 |
| InChIKey | XZGSFSKEUREBBD-CYBMUJFWSA-N |
| XLogP | 2.70 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |