About (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one
(2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one (PubChem CID 95561603) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one |
| PubChem CID | 95561603 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)[C@H](Cc1cccnc1)C2 |
| InChI | InChI=1S/C17H17NO3/c1-20-15-8-12-7-13(6-11-4-3-5-18-10-11)17(19)14(12)9-16(15)21-2/h3-5,8-10,13H,6-7H2,1-2H3/t13-/m1/s1 |
| InChIKey | XZGSFSKEUREBBD-CYBMUJFWSA-N |
| XLogP | 2.70 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one?
The IUPAC name of (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one (CID 95561603) is (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one.
What is the SMILES notation for (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one?
The canonical SMILES for (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one is COc1cc2c(cc1OC)C(=O)[C@H](Cc1cccnc1)C2.
What is the InChIKey of (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one?
The InChIKey is XZGSFSKEUREBBD-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H17NO3/c1-20-15-8-12-7-13(6-11-4-3-5-18-10-11)17(19)14(12)9-16(15)21-2/h3-5,8-10,13H,6-7H2,1-2H3/t13-/m1/s1.
What are the key properties of (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one?
(2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one has a molecular weight of 283.33 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5,6-dimethoxy-2-(pyridin-3-ylmethyl)-2,3-dihydroinden-1-one is sourced from PubChem (CID 95561603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).