C11H11N3O3 — CID 152782403
2-azido-5,6-dimethoxy-2,3-dihydroinden-1-one (PubChem CID 152782403) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 2-azido-5,6-dimethoxy-2,3-dihydroinden-1-one.
| Compound Name | 2-azido-5,6-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 152782403 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-azido-5,6-dimethoxy-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(N=[N+]=[N-])C2 |
| InChI | InChI=1S/C11H11N3O3/c1-16-9-4-6-3-8(13-14-12)11(15)7(6)5-10(9)17-2/h4-5,8H,3H2,1-2H3 |
| InChIKey | GHDJBVZYQSPBIR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|