C10H8FNO3 — CID 90875418
6-fluoro-5-methoxy-2-nitroso-2,3-dihydroinden-1-one (PubChem CID 90875418) has the molecular formula C10H8FNO3 and a molecular weight of 209.18 g/mol. Its IUPAC name is 6-fluoro-5-methoxy-2-nitroso-2,3-dihydroinden-1-one.
| Compound Name | 6-fluoro-5-methoxy-2-nitroso-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 90875418 |
| Molecular Formula | C10H8FNO3 |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 6-fluoro-5-methoxy-2-nitroso-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1F)C(=O)C(N=O)C2 |
| InChI | InChI=1S/C10H8FNO3/c1-15-9-3-5-2-8(12-14)10(13)6(5)4-7(9)11/h3-4,8H,2H2,1H3 |
| InChIKey | RQQUFSBFFXJYSR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |