C11H12FNO — CID 153364923
3-ethylidene-5-fluoro-6-methoxy-1,2-dihydroisoindole (PubChem CID 153364923) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is 3-ethylidene-5-fluoro-6-methoxy-1,2-dihydroisoindole.
| Compound Name | 3-ethylidene-5-fluoro-6-methoxy-1,2-dihydroisoindole |
|---|---|
| PubChem CID | 153364923 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-ethylidene-5-fluoro-6-methoxy-1,2-dihydroisoindole |
| SMILES | CC=C1NCc2cc(OC)c(F)cc21 |
| InChI | InChI=1S/C11H12FNO/c1-3-10-8-5-9(12)11(14-2)4-7(8)6-13-10/h3-5,13H,6H2,1-2H3 |
| InChIKey | VHBHJMCUSGITTJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |