C10H12FNOS — CID 114827363
7-fluoro-8-methoxy-2,3,4,5-tetrahydro-1,5-benzothiazepine (PubChem CID 114827363) has the molecular formula C10H12FNOS and a molecular weight of 213.28 g/mol. Its IUPAC name is 7-fluoro-8-methoxy-2,3,4,5-tetrahydro-1,5-benzothiazepine.
| Compound Name | 7-fluoro-8-methoxy-2,3,4,5-tetrahydro-1,5-benzothiazepine |
|---|---|
| PubChem CID | 114827363 |
| Molecular Formula | C10H12FNOS |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 7-fluoro-8-methoxy-2,3,4,5-tetrahydro-1,5-benzothiazepine |
| SMILES | COc1cc2c(cc1F)NCCCS2 |
| InChI | InChI=1S/C10H12FNOS/c1-13-9-6-10-8(5-7(9)11)12-3-2-4-14-10/h5-6,12H,2-4H2,1H3 |
| InChIKey | FGIGVKOHDQYYPD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|