C15H23FN2O — CID 107475377
3-(2,2-dimethylpropyl)-7-fluoro-8-methoxy-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine (PubChem CID 107475377) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-7-fluoro-8-methoxy-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine.
| Compound Name | 3-(2,2-dimethylpropyl)-7-fluoro-8-methoxy-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 107475377 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-7-fluoro-8-methoxy-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
| SMILES | COc1cc2c(cc1F)NCC(CC(C)(C)C)CN2 |
| InChI | InChI=1S/C15H23FN2O/c1-15(2,3)7-10-8-17-12-5-11(16)14(19-4)6-13(12)18-9-10/h5-6,10,17-18H,7-9H2,1-4H3 |
| InChIKey | TVAROODPJSBIOA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|