C12H18FNO — CID 145147315
ethane;6-fluoro-5-methoxy-2-methyl-2,3-dihydro-1H-indole (PubChem CID 145147315) has the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. Its IUPAC name is ethane;6-fluoro-5-methoxy-2-methyl-2,3-dihydro-1H-indole.
| Compound Name | ethane;6-fluoro-5-methoxy-2-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 145147315 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | ethane;6-fluoro-5-methoxy-2-methyl-2,3-dihydro-1H-indole |
| SMILES | CC.COc1cc2c(cc1F)NC(C)C2 |
| InChI | InChI=1S/C10H12FNO.C2H6/c1-6-3-7-4-10(13-2)8(11)5-9(7)12-6;1-2/h4-6,12H,3H2,1-2H3;1-2H3 |
| InChIKey | ZNFNCMRKXOIZIM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|