C14H16N2O2 — CID 68616350
(2Z)-2-(6,7-dimethoxy-3-methyl-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile (PubChem CID 68616350) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2Z)-2-(6,7-dimethoxy-3-methyl-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile.
| Compound Name | (2Z)-2-(6,7-dimethoxy-3-methyl-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile |
|---|---|
| PubChem CID | 68616350 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (2Z)-2-(6,7-dimethoxy-3-methyl-3,4-dihydro-2H-isoquinolin-1-ylidene)acetonitrile |
| SMILES | COc1cc2c(cc1OC)/C(=C/C#N)NC(C)C2 |
| InChI | InChI=1S/C14H16N2O2/c1-9-6-10-7-13(17-2)14(18-3)8-11(10)12(16-9)4-5-15/h4,7-9,16H,6H2,1-3H3/b12-4- |
| InChIKey | BWDLBVVUYWAKTC-QCDXTXTGSA-N |
| XLogP | 2.10 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|