C11H12F3NO — CID 84694331
5-methoxy-2-methyl-6-(trifluoromethyl)-2,3-dihydro-1H-indole (PubChem CID 84694331) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is 5-methoxy-2-methyl-6-(trifluoromethyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-methoxy-2-methyl-6-(trifluoromethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 84694331 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 5-methoxy-2-methyl-6-(trifluoromethyl)-2,3-dihydro-1H-indole |
| SMILES | COc1cc2c(cc1C(F)(F)F)NC(C)C2 |
| InChI | InChI=1S/C11H12F3NO/c1-6-3-7-4-10(16-2)8(11(12,13)14)5-9(7)15-6/h4-6,15H,3H2,1-2H3 |
| InChIKey | UHZCFXXCEDEIDL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|