C9H11FN2S — CID 170593348
S-(5-fluoro-2-methyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine (PubChem CID 170593348) has the molecular formula C9H11FN2S and a molecular weight of 198.27 g/mol. Its IUPAC name is S-(5-fluoro-2-methyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine.
| Compound Name | S-(5-fluoro-2-methyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine |
|---|---|
| PubChem CID | 170593348 |
| Molecular Formula | C9H11FN2S |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | S-(5-fluoro-2-methyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine |
| SMILES | CC1Cc2cc(F)c(SN)cc2N1 |
| InChI | InChI=1S/C9H11FN2S/c1-5-2-6-3-7(10)9(13-11)4-8(6)12-5/h3-5,12H,2,11H2,1H3 |
| InChIKey | UOQHVKDHWIPWQE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|