C11H15NO — CID 21441430
5-ethoxy-2-methyl-2,3-dihydro-1H-indole (PubChem CID 21441430) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 5-ethoxy-2-methyl-2,3-dihydro-1H-indole.
| Compound Name | 5-ethoxy-2-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 21441430 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 5-ethoxy-2-methyl-2,3-dihydro-1H-indole |
| SMILES | CCOc1ccc2c(c1)CC(C)N2 |
| InChI | InChI=1S/C11H15NO/c1-3-13-10-4-5-11-9(7-10)6-8(2)12-11/h4-5,7-8,12H,3,6H2,1-2H3 |
| InChIKey | IGJYLTQZHVZPFR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|