C17H16F3NO — CID 4657850
2-(4-ethoxyphenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indole (PubChem CID 4657850) has the molecular formula C17H16F3NO and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indole.
| Compound Name | 2-(4-ethoxyphenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 4657850 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-(4-ethoxyphenyl)-5-(trifluoromethyl)-2,3-dihydro-1H-indole |
| SMILES | CCOc1ccc(C2Cc3cc(C(F)(F)F)ccc3N2)cc1 |
| InChI | InChI=1S/C17H16F3NO/c1-2-22-14-6-3-11(4-7-14)16-10-12-9-13(17(18,19)20)5-8-15(12)21-16/h3-9,16,21H,2,10H2,1H3 |
| InChIKey | PCCJSVBPNHJUIN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |